About (5-aminothieno[2,3-c]pyridazin-6-yl)-(4,4-dimethylazepan-1-yl)methanone
(5-aminothieno[2,3-c]pyridazin-6-yl)-(4,4-dimethylazepan-1-yl)methanone (PubChem CID 80517277) has the molecular formula C15H20N4OS
and a molecular weight of 304.42 g/mol. Its IUPAC name is (5-aminothieno[2,3-c]pyridazin-6-yl)-(4,4-dimethylazepan-1-yl)methanone.
Molecular Properties
| Compound Name | (5-aminothieno[2,3-c]pyridazin-6-yl)-(4,4-dimethylazepan-1-yl)methanone |
| PubChem CID | 80517277 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (5-aminothieno[2,3-c]pyridazin-6-yl)-(4,4-dimethylazepan-1-yl)methanone |
| SMILES | CC1(C)CCCN(C(=O)c2sc3nnccc3c2N)CC1 |
| InChI | InChI=1S/C15H20N4OS/c1-15(2)5-3-8-19(9-6-15)14(20)12-11(16)10-4-7-17-18-13(10)21-12/h4,7H,3,5-6,8-9,16H2,1-2H3 |
| InChIKey | NEXRCKDMMWOCCL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-aminothieno[2,3-c]pyridazin-6-yl)-(4,4-dimethylazepan-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-aminothieno[2,3-c]pyridazin-6-yl)-(4,4-dimethylazepan-1-yl)methanone?
The IUPAC name of (5-aminothieno[2,3-c]pyridazin-6-yl)-(4,4-dimethylazepan-1-yl)methanone (CID 80517277) is (5-aminothieno[2,3-c]pyridazin-6-yl)-(4,4-dimethylazepan-1-yl)methanone.
What is the SMILES notation for (5-aminothieno[2,3-c]pyridazin-6-yl)-(4,4-dimethylazepan-1-yl)methanone?
The canonical SMILES for (5-aminothieno[2,3-c]pyridazin-6-yl)-(4,4-dimethylazepan-1-yl)methanone is CC1(C)CCCN(C(=O)c2sc3nnccc3c2N)CC1.
What is the InChIKey of (5-aminothieno[2,3-c]pyridazin-6-yl)-(4,4-dimethylazepan-1-yl)methanone?
The InChIKey is NEXRCKDMMWOCCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4OS/c1-15(2)5-3-8-19(9-6-15)14(20)12-11(16)10-4-7-17-18-13(10)21-12/h4,7H,3,5-6,8-9,16H2,1-2H3.
What are the key properties of (5-aminothieno[2,3-c]pyridazin-6-yl)-(4,4-dimethylazepan-1-yl)methanone?
(5-aminothieno[2,3-c]pyridazin-6-yl)-(4,4-dimethylazepan-1-yl)methanone has a molecular weight of 304.42 g/mol, XLogP of 2.93, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-aminothieno[2,3-c]pyridazin-6-yl)-(4,4-dimethylazepan-1-yl)methanone is sourced from PubChem (CID 80517277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).