C12H18N2O4 — CID 80517318
5,6-diethyl-3-(3-hydroxypropoxy)pyridazine-4-carboxylic acid (PubChem CID 80517318) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 5,6-diethyl-3-(3-hydroxypropoxy)pyridazine-4-carboxylic acid.
| Compound Name | 5,6-diethyl-3-(3-hydroxypropoxy)pyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 80517318 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 5,6-diethyl-3-(3-hydroxypropoxy)pyridazine-4-carboxylic acid |
| SMILES | CCc1nnc(OCCCO)c(C(=O)O)c1CC |
| InChI | InChI=1S/C12H18N2O4/c1-3-8-9(4-2)13-14-11(10(8)12(16)17)18-7-5-6-15/h15H,3-7H2,1-2H3,(H,16,17) |
| InChIKey | HEQUEVJBFDDCFP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|