5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid

C16H18N2O3 — CID 80517524

IUPAC5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid
SMILESCCc1nnc(Oc2cccc(C)c2)c(C(=O)O)c1CC
InChIInChI=1S/C16H18N2O3/c1-4-12-13(5-2)17-18-15(14(12)16(19)20)21-11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3,(H,19,20)
InChIKeyGXBNVTOSWIKQBM-UHFFFAOYSA-N
MW286.33 g/mol
LogP3.40
Rot. Bonds5

About 5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid

5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid (PubChem CID 80517524) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid.

Molecular Properties

Compound Name5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid
PubChem CID80517524
Molecular FormulaC16H18N2O3
Molecular Weight286.33 g/mol
Exact Mass286.13
IUPAC Name5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid
SMILESCCc1nnc(Oc2cccc(C)c2)c(C(=O)O)c1CC
InChIInChI=1S/C16H18N2O3/c1-4-12-13(5-2)17-18-15(14(12)16(19)20)21-11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3,(H,19,20)
InChIKeyGXBNVTOSWIKQBM-UHFFFAOYSA-N
XLogP3.40
TPSA72.31 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.33
LogP ≤ 53.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid?
The IUPAC name of 5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid (CID 80517524) is 5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid.
What is the SMILES notation for 5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid?
The canonical SMILES for 5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid is CCc1nnc(Oc2cccc(C)c2)c(C(=O)O)c1CC.
What is the InChIKey of 5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid?
The InChIKey is GXBNVTOSWIKQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3/c1-4-12-13(5-2)17-18-15(14(12)16(19)20)21-11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3,(H,19,20).
What are the key properties of 5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid?
5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid has a molecular weight of 286.33 g/mol, XLogP of 3.40, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diethyl-3-(3-methylphenoxy)pyridazine-4-carboxylic acid is sourced from PubChem (CID 80517524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).