C15H23N3O3 — CID 80517737
5,6-diethyl-3-(oxan-2-ylmethylamino)pyridazine-4-carboxylic acid (PubChem CID 80517737) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 5,6-diethyl-3-(oxan-2-ylmethylamino)pyridazine-4-carboxylic acid.
| Compound Name | 5,6-diethyl-3-(oxan-2-ylmethylamino)pyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 80517737 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 5,6-diethyl-3-(oxan-2-ylmethylamino)pyridazine-4-carboxylic acid |
| SMILES | CCc1nnc(NCC2CCCCO2)c(C(=O)O)c1CC |
| InChI | InChI=1S/C15H23N3O3/c1-3-11-12(4-2)17-18-14(13(11)15(19)20)16-9-10-7-5-6-8-21-10/h10H,3-9H2,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | KIVBFHPKRMCVEO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |