About 2-[1,1-dioxo-4-(thiadiazole-4-carbonyl)-1,4-thiazinan-3-yl]acetic acid
2-[1,1-dioxo-4-(thiadiazole-4-carbonyl)-1,4-thiazinan-3-yl]acetic acid (PubChem CID 80518587) has the molecular formula C9H11N3O5S2
and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-[1,1-dioxo-4-(thiadiazole-4-carbonyl)-1,4-thiazinan-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[1,1-dioxo-4-(thiadiazole-4-carbonyl)-1,4-thiazinan-3-yl]acetic acid |
| PubChem CID | 80518587 |
| Molecular Formula | C9H11N3O5S2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 2-[1,1-dioxo-4-(thiadiazole-4-carbonyl)-1,4-thiazinan-3-yl]acetic acid |
| SMILES | O=C(O)CC1CS(=O)(=O)CCN1C(=O)c1csnn1 |
| InChI | InChI=1S/C9H11N3O5S2/c13-8(14)3-6-5-19(16,17)2-1-12(6)9(15)7-4-18-11-10-7/h4,6H,1-3,5H2,(H,13,14) |
| InChIKey | ZUFOGYIPMLQQPS-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[1,1-dioxo-4-(thiadiazole-4-carbonyl)-1,4-thiazinan-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,1-dioxo-4-(thiadiazole-4-carbonyl)-1,4-thiazinan-3-yl]acetic acid?
The IUPAC name of 2-[1,1-dioxo-4-(thiadiazole-4-carbonyl)-1,4-thiazinan-3-yl]acetic acid (CID 80518587) is 2-[1,1-dioxo-4-(thiadiazole-4-carbonyl)-1,4-thiazinan-3-yl]acetic acid.
What is the SMILES notation for 2-[1,1-dioxo-4-(thiadiazole-4-carbonyl)-1,4-thiazinan-3-yl]acetic acid?
The canonical SMILES for 2-[1,1-dioxo-4-(thiadiazole-4-carbonyl)-1,4-thiazinan-3-yl]acetic acid is O=C(O)CC1CS(=O)(=O)CCN1C(=O)c1csnn1.
What is the InChIKey of 2-[1,1-dioxo-4-(thiadiazole-4-carbonyl)-1,4-thiazinan-3-yl]acetic acid?
The InChIKey is ZUFOGYIPMLQQPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O5S2/c13-8(14)3-6-5-19(16,17)2-1-12(6)9(15)7-4-18-11-10-7/h4,6H,1-3,5H2,(H,13,14).
What are the key properties of 2-[1,1-dioxo-4-(thiadiazole-4-carbonyl)-1,4-thiazinan-3-yl]acetic acid?
2-[1,1-dioxo-4-(thiadiazole-4-carbonyl)-1,4-thiazinan-3-yl]acetic acid has a molecular weight of 305.34 g/mol, XLogP of -0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,1-dioxo-4-(thiadiazole-4-carbonyl)-1,4-thiazinan-3-yl]acetic acid is sourced from PubChem (CID 80518587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).