2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid

C9H15NO5S — CID 80518672

IUPAC2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid
SMILESCCC(=O)N1CCS(=O)(=O)CC1CC(=O)O
InChIInChI=1S/C9H15NO5S/c1-2-8(11)10-3-4-16(14,15)6-7(10)5-9(12)13/h7H,2-6H2,1H3,(H,12,13)
InChIKeyYJOMFIHWGXJQJC-UHFFFAOYSA-N
MW249.29 g/mol
LogP-0.50
Rot. Bonds3

About 2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid

2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid (PubChem CID 80518672) has the molecular formula C9H15NO5S and a molecular weight of 249.29 g/mol. Its IUPAC name is 2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid.

Molecular Properties

Compound Name2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid
PubChem CID80518672
Molecular FormulaC9H15NO5S
Molecular Weight249.29 g/mol
Exact Mass249.07
IUPAC Name2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid
SMILESCCC(=O)N1CCS(=O)(=O)CC1CC(=O)O
InChIInChI=1S/C9H15NO5S/c1-2-8(11)10-3-4-16(14,15)6-7(10)5-9(12)13/h7H,2-6H2,1H3,(H,12,13)
InChIKeyYJOMFIHWGXJQJC-UHFFFAOYSA-N
XLogP-0.50
TPSA91.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.29
LogP ≤ 5-0.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid?
The IUPAC name of 2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid (CID 80518672) is 2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid.
What is the SMILES notation for 2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid?
The canonical SMILES for 2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid is CCC(=O)N1CCS(=O)(=O)CC1CC(=O)O.
What is the InChIKey of 2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid?
The InChIKey is YJOMFIHWGXJQJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO5S/c1-2-8(11)10-3-4-16(14,15)6-7(10)5-9(12)13/h7H,2-6H2,1H3,(H,12,13).
What are the key properties of 2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid?
2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid has a molecular weight of 249.29 g/mol, XLogP of -0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid is sourced from PubChem (CID 80518672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).