C9H15NO5S — CID 80518672
2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid (PubChem CID 80518672) has the molecular formula C9H15NO5S and a molecular weight of 249.29 g/mol. Its IUPAC name is 2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid.
| Compound Name | 2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid |
|---|---|
| PubChem CID | 80518672 |
| Molecular Formula | C9H15NO5S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-(1,1-dioxo-4-propanoyl-1,4-thiazinan-3-yl)acetic acid |
| SMILES | CCC(=O)N1CCS(=O)(=O)CC1CC(=O)O |
| InChI | InChI=1S/C9H15NO5S/c1-2-8(11)10-3-4-16(14,15)6-7(10)5-9(12)13/h7H,2-6H2,1H3,(H,12,13) |
| InChIKey | YJOMFIHWGXJQJC-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |