About 2-[1,1-dioxo-4-(2-oxoazepan-4-yl)-1,4-thiazinan-3-yl]acetic acid
2-[1,1-dioxo-4-(2-oxoazepan-4-yl)-1,4-thiazinan-3-yl]acetic acid (PubChem CID 80519322) has the molecular formula C12H20N2O5S
and a molecular weight of 304.37 g/mol. Its IUPAC name is 2-[1,1-dioxo-4-(2-oxoazepan-4-yl)-1,4-thiazinan-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[1,1-dioxo-4-(2-oxoazepan-4-yl)-1,4-thiazinan-3-yl]acetic acid |
| PubChem CID | 80519322 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-[1,1-dioxo-4-(2-oxoazepan-4-yl)-1,4-thiazinan-3-yl]acetic acid |
| SMILES | O=C(O)CC1CS(=O)(=O)CCN1C1CCCNC(=O)C1 |
| InChI | InChI=1S/C12H20N2O5S/c15-11-6-9(2-1-3-13-11)14-4-5-20(18,19)8-10(14)7-12(16)17/h9-10H,1-8H2,(H,13,15)(H,16,17) |
| InChIKey | GBWZMZQROHKEGS-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1,1-dioxo-4-(2-oxoazepan-4-yl)-1,4-thiazinan-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,1-dioxo-4-(2-oxoazepan-4-yl)-1,4-thiazinan-3-yl]acetic acid?
The IUPAC name of 2-[1,1-dioxo-4-(2-oxoazepan-4-yl)-1,4-thiazinan-3-yl]acetic acid (CID 80519322) is 2-[1,1-dioxo-4-(2-oxoazepan-4-yl)-1,4-thiazinan-3-yl]acetic acid.
What is the SMILES notation for 2-[1,1-dioxo-4-(2-oxoazepan-4-yl)-1,4-thiazinan-3-yl]acetic acid?
The canonical SMILES for 2-[1,1-dioxo-4-(2-oxoazepan-4-yl)-1,4-thiazinan-3-yl]acetic acid is O=C(O)CC1CS(=O)(=O)CCN1C1CCCNC(=O)C1.
What is the InChIKey of 2-[1,1-dioxo-4-(2-oxoazepan-4-yl)-1,4-thiazinan-3-yl]acetic acid?
The InChIKey is GBWZMZQROHKEGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O5S/c15-11-6-9(2-1-3-13-11)14-4-5-20(18,19)8-10(14)7-12(16)17/h9-10H,1-8H2,(H,13,15)(H,16,17).
What are the key properties of 2-[1,1-dioxo-4-(2-oxoazepan-4-yl)-1,4-thiazinan-3-yl]acetic acid?
2-[1,1-dioxo-4-(2-oxoazepan-4-yl)-1,4-thiazinan-3-yl]acetic acid has a molecular weight of 304.37 g/mol, XLogP of -0.77, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,1-dioxo-4-(2-oxoazepan-4-yl)-1,4-thiazinan-3-yl]acetic acid is sourced from PubChem (CID 80519322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).