About 2-(1,1-dioxo-4-prop-2-ynyl-1,4-thiazinan-3-yl)acetic acid
2-(1,1-dioxo-4-prop-2-ynyl-1,4-thiazinan-3-yl)acetic acid (PubChem CID 80519378) has the molecular formula C9H13NO4S
and a molecular weight of 231.27 g/mol. Its IUPAC name is 2-(1,1-dioxo-4-prop-2-ynyl-1,4-thiazinan-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(1,1-dioxo-4-prop-2-ynyl-1,4-thiazinan-3-yl)acetic acid |
| PubChem CID | 80519378 |
| Molecular Formula | C9H13NO4S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 2-(1,1-dioxo-4-prop-2-ynyl-1,4-thiazinan-3-yl)acetic acid |
| SMILES | C#CCN1CCS(=O)(=O)CC1CC(=O)O |
| InChI | InChI=1S/C9H13NO4S/c1-2-3-10-4-5-15(13,14)7-8(10)6-9(11)12/h1,8H,3-7H2,(H,11,12) |
| InChIKey | BXTQBHUHKXSNPT-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,1-dioxo-4-prop-2-ynyl-1,4-thiazinan-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxo-4-prop-2-ynyl-1,4-thiazinan-3-yl)acetic acid?
The IUPAC name of 2-(1,1-dioxo-4-prop-2-ynyl-1,4-thiazinan-3-yl)acetic acid (CID 80519378) is 2-(1,1-dioxo-4-prop-2-ynyl-1,4-thiazinan-3-yl)acetic acid.
What is the SMILES notation for 2-(1,1-dioxo-4-prop-2-ynyl-1,4-thiazinan-3-yl)acetic acid?
The canonical SMILES for 2-(1,1-dioxo-4-prop-2-ynyl-1,4-thiazinan-3-yl)acetic acid is C#CCN1CCS(=O)(=O)CC1CC(=O)O.
What is the InChIKey of 2-(1,1-dioxo-4-prop-2-ynyl-1,4-thiazinan-3-yl)acetic acid?
The InChIKey is BXTQBHUHKXSNPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO4S/c1-2-3-10-4-5-15(13,14)7-8(10)6-9(11)12/h1,8H,3-7H2,(H,11,12).
What are the key properties of 2-(1,1-dioxo-4-prop-2-ynyl-1,4-thiazinan-3-yl)acetic acid?
2-(1,1-dioxo-4-prop-2-ynyl-1,4-thiazinan-3-yl)acetic acid has a molecular weight of 231.27 g/mol, XLogP of -0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxo-4-prop-2-ynyl-1,4-thiazinan-3-yl)acetic acid is sourced from PubChem (CID 80519378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).