C11H18N2O3 — CID 80519553
7-tert-butyl-3,4,9,9a-tetrahydro-1H-pyrimido[6,1-c][1,4]oxazine-6,8-dione (PubChem CID 80519553) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 7-tert-butyl-3,4,9,9a-tetrahydro-1H-pyrimido[6,1-c][1,4]oxazine-6,8-dione.
| Compound Name | 7-tert-butyl-3,4,9,9a-tetrahydro-1H-pyrimido[6,1-c][1,4]oxazine-6,8-dione |
|---|---|
| PubChem CID | 80519553 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 7-tert-butyl-3,4,9,9a-tetrahydro-1H-pyrimido[6,1-c][1,4]oxazine-6,8-dione |
| SMILES | CC(C)(C)N1C(=O)CC2COCCN2C1=O |
| InChI | InChI=1S/C11H18N2O3/c1-11(2,3)13-9(14)6-8-7-16-5-4-12(8)10(13)15/h8H,4-7H2,1-3H3 |
| InChIKey | IAXDTJCPSRCPDM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |