About 5-(1,3-dihydro-2-benzofuran-5-yl)-4-pyridin-2-yl-1H-pyrazol-3-amine
5-(1,3-dihydro-2-benzofuran-5-yl)-4-pyridin-2-yl-1H-pyrazol-3-amine (PubChem CID 80519875) has the molecular formula C16H14N4O
and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-(1,3-dihydro-2-benzofuran-5-yl)-4-pyridin-2-yl-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-(1,3-dihydro-2-benzofuran-5-yl)-4-pyridin-2-yl-1H-pyrazol-3-amine |
| PubChem CID | 80519875 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 5-(1,3-dihydro-2-benzofuran-5-yl)-4-pyridin-2-yl-1H-pyrazol-3-amine |
| SMILES | Nc1n[nH]c(-c2ccc3c(c2)COC3)c1-c1ccccn1 |
| InChI | InChI=1S/C16H14N4O/c17-16-14(13-3-1-2-6-18-13)15(19-20-16)10-4-5-11-8-21-9-12(11)7-10/h1-7H,8-9H2,(H3,17,19,20) |
| InChIKey | JNTJWINXENYZMD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,3-dihydro-2-benzofuran-5-yl)-4-pyridin-2-yl-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dihydro-2-benzofuran-5-yl)-4-pyridin-2-yl-1H-pyrazol-3-amine?
The IUPAC name of 5-(1,3-dihydro-2-benzofuran-5-yl)-4-pyridin-2-yl-1H-pyrazol-3-amine (CID 80519875) is 5-(1,3-dihydro-2-benzofuran-5-yl)-4-pyridin-2-yl-1H-pyrazol-3-amine.
What is the SMILES notation for 5-(1,3-dihydro-2-benzofuran-5-yl)-4-pyridin-2-yl-1H-pyrazol-3-amine?
The canonical SMILES for 5-(1,3-dihydro-2-benzofuran-5-yl)-4-pyridin-2-yl-1H-pyrazol-3-amine is Nc1n[nH]c(-c2ccc3c(c2)COC3)c1-c1ccccn1.
What is the InChIKey of 5-(1,3-dihydro-2-benzofuran-5-yl)-4-pyridin-2-yl-1H-pyrazol-3-amine?
The InChIKey is JNTJWINXENYZMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O/c17-16-14(13-3-1-2-6-18-13)15(19-20-16)10-4-5-11-8-21-9-12(11)7-10/h1-7H,8-9H2,(H3,17,19,20).
What are the key properties of 5-(1,3-dihydro-2-benzofuran-5-yl)-4-pyridin-2-yl-1H-pyrazol-3-amine?
5-(1,3-dihydro-2-benzofuran-5-yl)-4-pyridin-2-yl-1H-pyrazol-3-amine has a molecular weight of 278.31 g/mol, XLogP of 2.75, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dihydro-2-benzofuran-5-yl)-4-pyridin-2-yl-1H-pyrazol-3-amine is sourced from PubChem (CID 80519875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).