C12H22N2O4S — CID 80520256
2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(oxan-3-ylmethyl)acetamide (PubChem CID 80520256) has the molecular formula C12H22N2O4S and a molecular weight of 290.38 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(oxan-3-ylmethyl)acetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(oxan-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 80520256 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(oxan-3-ylmethyl)acetamide |
| SMILES | O=C(CC1CS(=O)(=O)CCN1)NCC1CCCOC1 |
| InChI | InChI=1S/C12H22N2O4S/c15-12(14-7-10-2-1-4-18-8-10)6-11-9-19(16,17)5-3-13-11/h10-11,13H,1-9H2,(H,14,15) |
| InChIKey | WNGLVXGRRGJIIS-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |