C10H17F3N2O4S — CID 80520789
2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide (PubChem CID 80520789) has the molecular formula C10H17F3N2O4S and a molecular weight of 318.32 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 80520789 |
| Molecular Formula | C10H17F3N2O4S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide |
| SMILES | O=C(CC1CS(=O)(=O)CCN1)NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O4S/c11-10(12,13)7-19-3-1-15-9(16)5-8-6-20(17,18)4-2-14-8/h8,14H,1-7H2,(H,15,16) |
| InChIKey | GCKJTBFCRDOOKB-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|