C13H22N2O2S2 — CID 80521073
N-[(4,5-dimethylthiophen-2-yl)methyl]-2-(1,1-dioxo-1,4-thiazinan-3-yl)ethanamine (PubChem CID 80521073) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.47 g/mol. Its IUPAC name is N-[(4,5-dimethylthiophen-2-yl)methyl]-2-(1,1-dioxo-1,4-thiazinan-3-yl)ethanamine.
| Compound Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-2-(1,1-dioxo-1,4-thiazinan-3-yl)ethanamine |
|---|---|
| PubChem CID | 80521073 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-2-(1,1-dioxo-1,4-thiazinan-3-yl)ethanamine |
| SMILES | Cc1cc(CNCCC2CS(=O)(=O)CCN2)sc1C |
| InChI | InChI=1S/C13H22N2O2S2/c1-10-7-13(18-11(10)2)8-14-4-3-12-9-19(16,17)6-5-15-12/h7,12,14-15H,3-6,8-9H2,1-2H3 |
| InChIKey | CGTACCLJZKTTPJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|