C17H17N3O — CID 80521077
4-pyridin-2-yl-3-(2,4,6-trimethylphenyl)-1,2-oxazol-5-amine (PubChem CID 80521077) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is 4-pyridin-2-yl-3-(2,4,6-trimethylphenyl)-1,2-oxazol-5-amine.
| Compound Name | 4-pyridin-2-yl-3-(2,4,6-trimethylphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 80521077 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 4-pyridin-2-yl-3-(2,4,6-trimethylphenyl)-1,2-oxazol-5-amine |
| SMILES | Cc1cc(C)c(-c2noc(N)c2-c2ccccn2)c(C)c1 |
| InChI | InChI=1S/C17H17N3O/c1-10-8-11(2)14(12(3)9-10)16-15(17(18)21-20-16)13-6-4-5-7-19-13/h4-9H,18H2,1-3H3 |
| InChIKey | HHQPLPULKJOMTD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |