About 5-(2,3-dimethylphenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine
5-(2,3-dimethylphenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine (PubChem CID 80521578) has the molecular formula C16H15N3O
and a molecular weight of 265.32 g/mol. Its IUPAC name is 5-(2,3-dimethylphenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 5-(2,3-dimethylphenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine |
| PubChem CID | 80521578 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 5-(2,3-dimethylphenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine |
| SMILES | Cc1cccc(-c2onc(N)c2-c2ccccn2)c1C |
| InChI | InChI=1S/C16H15N3O/c1-10-6-5-7-12(11(10)2)15-14(16(17)19-20-15)13-8-3-4-9-18-13/h3-9H,1-2H3,(H2,17,19) |
| InChIKey | KIOMZCVNZSMXMW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,3-dimethylphenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dimethylphenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine?
The IUPAC name of 5-(2,3-dimethylphenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine (CID 80521578) is 5-(2,3-dimethylphenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine.
What is the SMILES notation for 5-(2,3-dimethylphenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine?
The canonical SMILES for 5-(2,3-dimethylphenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine is Cc1cccc(-c2onc(N)c2-c2ccccn2)c1C.
What is the InChIKey of 5-(2,3-dimethylphenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine?
The InChIKey is KIOMZCVNZSMXMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O/c1-10-6-5-7-12(11(10)2)15-14(16(17)19-20-15)13-8-3-4-9-18-13/h3-9H,1-2H3,(H2,17,19).
What are the key properties of 5-(2,3-dimethylphenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine?
5-(2,3-dimethylphenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine has a molecular weight of 265.32 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dimethylphenyl)-4-pyridin-2-yl-1,2-oxazol-3-amine is sourced from PubChem (CID 80521578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).