C11H19N3O2S2 — CID 80522146
2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]ethanamine (PubChem CID 80522146) has the molecular formula C11H19N3O2S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]ethanamine.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 80522146 |
| Molecular Formula | C11H19N3O2S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-[(2-methyl-1,3-thiazol-5-yl)methyl]ethanamine |
| SMILES | Cc1ncc(CNCCC2CS(=O)(=O)CCN2)s1 |
| InChI | InChI=1S/C11H19N3O2S2/c1-9-14-7-11(17-9)6-12-3-2-10-8-18(15,16)5-4-13-10/h7,10,12-13H,2-6,8H2,1H3 |
| InChIKey | PYLDLDSDIRMVFH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|