C10H17N3O2S2 — CID 80522147
2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(1,3-thiazol-2-ylmethyl)ethanamine (PubChem CID 80522147) has the molecular formula C10H17N3O2S2 and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(1,3-thiazol-2-ylmethyl)ethanamine.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(1,3-thiazol-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 80522147 |
| Molecular Formula | C10H17N3O2S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(1,3-thiazol-2-ylmethyl)ethanamine |
| SMILES | O=S1(=O)CCNC(CCNCc2nccs2)C1 |
| InChI | InChI=1S/C10H17N3O2S2/c14-17(15)6-4-12-9(8-17)1-2-11-7-10-13-3-5-16-10/h3,5,9,11-12H,1-2,4,6-8H2 |
| InChIKey | LPQPBLHZNBGPKH-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|