C12H15N3S — CID 80524528
N-[(3-pyridin-4-yl-1,2-thiazol-5-yl)methyl]propan-1-amine (PubChem CID 80524528) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is N-[(3-pyridin-4-yl-1,2-thiazol-5-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-pyridin-4-yl-1,2-thiazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 80524528 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N-[(3-pyridin-4-yl-1,2-thiazol-5-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1cc(-c2ccncc2)ns1 |
| InChI | InChI=1S/C12H15N3S/c1-2-5-14-9-11-8-12(15-16-11)10-3-6-13-7-4-10/h3-4,6-8,14H,2,5,9H2,1H3 |
| InChIKey | NYRIAXVNAMXTHO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|