C15H21N3O — CID 80524936
4-pyridin-4-yl-5-(2,3,3-trimethylbutyl)-1,2-oxazol-3-amine (PubChem CID 80524936) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-pyridin-4-yl-5-(2,3,3-trimethylbutyl)-1,2-oxazol-3-amine.
| Compound Name | 4-pyridin-4-yl-5-(2,3,3-trimethylbutyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 80524936 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 4-pyridin-4-yl-5-(2,3,3-trimethylbutyl)-1,2-oxazol-3-amine |
| SMILES | CC(Cc1onc(N)c1-c1ccncc1)C(C)(C)C |
| InChI | InChI=1S/C15H21N3O/c1-10(15(2,3)4)9-12-13(14(16)18-19-12)11-5-7-17-8-6-11/h5-8,10H,9H2,1-4H3,(H2,16,18) |
| InChIKey | KSFRLAFHVTZQCC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |