C14H8Cl2N2O — CID 80525125
3-(3,4-dichlorophenyl)-3-oxo-2-pyridin-4-ylpropanenitrile (PubChem CID 80525125) has the molecular formula C14H8Cl2N2O and a molecular weight of 291.14 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-3-oxo-2-pyridin-4-ylpropanenitrile.
| Compound Name | 3-(3,4-dichlorophenyl)-3-oxo-2-pyridin-4-ylpropanenitrile |
|---|---|
| PubChem CID | 80525125 |
| Molecular Formula | C14H8Cl2N2O |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-3-oxo-2-pyridin-4-ylpropanenitrile |
| SMILES | N#CC(C(=O)c1ccc(Cl)c(Cl)c1)c1ccncc1 |
| InChI | InChI=1S/C14H8Cl2N2O/c15-12-2-1-10(7-13(12)16)14(19)11(8-17)9-3-5-18-6-4-9/h1-7,11H |
| InChIKey | SULRSPSNJFOPRP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |