C15H13N3OS — CID 80525895
5-(2-methylsulfanylphenyl)-4-pyridin-4-yl-1,2-oxazol-3-amine (PubChem CID 80525895) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is 5-(2-methylsulfanylphenyl)-4-pyridin-4-yl-1,2-oxazol-3-amine.
| Compound Name | 5-(2-methylsulfanylphenyl)-4-pyridin-4-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 80525895 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 5-(2-methylsulfanylphenyl)-4-pyridin-4-yl-1,2-oxazol-3-amine |
| SMILES | CSc1ccccc1-c1onc(N)c1-c1ccncc1 |
| InChI | InChI=1S/C15H13N3OS/c1-20-12-5-3-2-4-11(12)14-13(15(16)18-19-14)10-6-8-17-9-7-10/h2-9H,1H3,(H2,16,18) |
| InChIKey | ULESQFAFMSFSQQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |