C12H15ClN4 — CID 80525912
2-chloro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]pyridin-4-amine (PubChem CID 80525912) has the molecular formula C12H15ClN4 and a molecular weight of 250.73 g/mol. Its IUPAC name is 2-chloro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]pyridin-4-amine.
| Compound Name | 2-chloro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 80525912 |
| Molecular Formula | C12H15ClN4 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-chloro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]pyridin-4-amine |
| SMILES | Cc1nn(C)c(C)c1CNc1ccnc(Cl)c1 |
| InChI | InChI=1S/C12H15ClN4/c1-8-11(9(2)17(3)16-8)7-15-10-4-5-14-12(13)6-10/h4-6H,7H2,1-3H3,(H,14,15) |
| InChIKey | UPWYLGQRQUKVBH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|