C13H17N3S — CID 80525997
5-N-(2-methyl-2-thiophen-2-ylpropyl)pyridine-2,5-diamine (PubChem CID 80525997) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is 5-N-(2-methyl-2-thiophen-2-ylpropyl)pyridine-2,5-diamine.
| Compound Name | 5-N-(2-methyl-2-thiophen-2-ylpropyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 80525997 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 5-N-(2-methyl-2-thiophen-2-ylpropyl)pyridine-2,5-diamine |
| SMILES | CC(C)(CNc1ccc(N)nc1)c1cccs1 |
| InChI | InChI=1S/C13H17N3S/c1-13(2,11-4-3-7-17-11)9-16-10-5-6-12(14)15-8-10/h3-8,16H,9H2,1-2H3,(H2,14,15) |
| InChIKey | OIQXQQKYSOHSCX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |