C13H21NOS2 — CID 80526167
N-(2-methyl-2-thiophen-2-ylpropyl)-1-oxothian-4-amine (PubChem CID 80526167) has the molecular formula C13H21NOS2 and a molecular weight of 271.45 g/mol. Its IUPAC name is N-(2-methyl-2-thiophen-2-ylpropyl)-1-oxothian-4-amine.
| Compound Name | N-(2-methyl-2-thiophen-2-ylpropyl)-1-oxothian-4-amine |
|---|---|
| PubChem CID | 80526167 |
| Molecular Formula | C13H21NOS2 |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-(2-methyl-2-thiophen-2-ylpropyl)-1-oxothian-4-amine |
| SMILES | CC(C)(CNC1CCS(=O)CC1)c1cccs1 |
| InChI | InChI=1S/C13H21NOS2/c1-13(2,12-4-3-7-16-12)10-14-11-5-8-17(15)9-6-11/h3-4,7,11,14H,5-6,8-10H2,1-2H3 |
| InChIKey | IUDFSSHLSVMMPG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |