C15H17F3N2S — CID 80526342
1-N-(2-methyl-2-thiophen-2-ylpropyl)-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 80526342) has the molecular formula C15H17F3N2S and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-N-(2-methyl-2-thiophen-2-ylpropyl)-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-(2-methyl-2-thiophen-2-ylpropyl)-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 80526342 |
| Molecular Formula | C15H17F3N2S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-N-(2-methyl-2-thiophen-2-ylpropyl)-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CC(C)(CNc1ccc(N)cc1C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C15H17F3N2S/c1-14(2,13-4-3-7-21-13)9-20-12-6-5-10(19)8-11(12)15(16,17)18/h3-8,20H,9,19H2,1-2H3 |
| InChIKey | AWWONHJNFODEBH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|