C16H20N2O — CID 80527108
3-amino-1-(2,3-dimethylphenyl)-2-pyridin-2-ylpropan-1-ol (PubChem CID 80527108) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-amino-1-(2,3-dimethylphenyl)-2-pyridin-2-ylpropan-1-ol.
| Compound Name | 3-amino-1-(2,3-dimethylphenyl)-2-pyridin-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 80527108 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3-amino-1-(2,3-dimethylphenyl)-2-pyridin-2-ylpropan-1-ol |
| SMILES | Cc1cccc(C(O)C(CN)c2ccccn2)c1C |
| InChI | InChI=1S/C16H20N2O/c1-11-6-5-7-13(12(11)2)16(19)14(10-17)15-8-3-4-9-18-15/h3-9,14,16,19H,10,17H2,1-2H3 |
| InChIKey | FGYZZEIPEXYRRG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |