C13H15NO3S — CID 80528245
5-[(2-methyl-2-thiophen-2-ylpropyl)amino]furan-2-carboxylic acid (PubChem CID 80528245) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is 5-[(2-methyl-2-thiophen-2-ylpropyl)amino]furan-2-carboxylic acid.
| Compound Name | 5-[(2-methyl-2-thiophen-2-ylpropyl)amino]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 80528245 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 5-[(2-methyl-2-thiophen-2-ylpropyl)amino]furan-2-carboxylic acid |
| SMILES | CC(C)(CNc1ccc(C(=O)O)o1)c1cccs1 |
| InChI | InChI=1S/C13H15NO3S/c1-13(2,10-4-3-7-18-10)8-14-11-6-5-9(17-11)12(15)16/h3-7,14H,8H2,1-2H3,(H,15,16) |
| InChIKey | KRRXDGJQEJGAAJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |