About N-(5-chloro-2-pyridinyl)-2,2-diphenylpropanamide
N-(5-chloro-2-pyridinyl)-2,2-diphenylpropanamide (PubChem CID 805285) has the molecular formula C20H17ClN2O
and a molecular weight of 336.82 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2,2-diphenylpropanamide.
Molecular Properties
| Compound Name | N-(5-chloro-2-pyridinyl)-2,2-diphenylpropanamide |
| PubChem CID | 805285 |
| Molecular Formula | C20H17ClN2O |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2,2-diphenylpropanamide |
| SMILES | CC(C(=O)Nc1ccc(Cl)cn1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H17ClN2O/c1-20(15-8-4-2-5-9-15,16-10-6-3-7-11-16)19(24)23-18-13-12-17(21)14-22-18/h2-14H,1H3,(H,22,23,24) |
| InChIKey | HNHRAULTNRIILH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(5-chloro-2-pyridinyl)-2,2-diphenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-2-pyridinyl)-2,2-diphenylpropanamide?
The IUPAC name of N-(5-chloro-2-pyridinyl)-2,2-diphenylpropanamide (CID 805285) is N-(5-chloro-2-pyridinyl)-2,2-diphenylpropanamide.
What is the SMILES notation for N-(5-chloro-2-pyridinyl)-2,2-diphenylpropanamide?
The canonical SMILES for N-(5-chloro-2-pyridinyl)-2,2-diphenylpropanamide is CC(C(=O)Nc1ccc(Cl)cn1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(5-chloro-2-pyridinyl)-2,2-diphenylpropanamide?
The InChIKey is HNHRAULTNRIILH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClN2O/c1-20(15-8-4-2-5-9-15,16-10-6-3-7-11-16)19(24)23-18-13-12-17(21)14-22-18/h2-14H,1H3,(H,22,23,24).
What are the key properties of N-(5-chloro-2-pyridinyl)-2,2-diphenylpropanamide?
N-(5-chloro-2-pyridinyl)-2,2-diphenylpropanamide has a molecular weight of 336.82 g/mol, XLogP of 4.68, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-2-pyridinyl)-2,2-diphenylpropanamide is sourced from PubChem (CID 805285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).