About 1-(3-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-one
1-(3-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-one (PubChem CID 80529884) has the molecular formula C12H17ClOS
and a molecular weight of 244.79 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-one.
Molecular Properties
| Compound Name | 1-(3-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-one |
| PubChem CID | 80529884 |
| Molecular Formula | C12H17ClOS |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-one |
| SMILES | CC(CC(=O)c1sccc1Cl)C(C)(C)C |
| InChI | InChI=1S/C12H17ClOS/c1-8(12(2,3)4)7-10(14)11-9(13)5-6-15-11/h5-6,8H,7H2,1-4H3 |
| InChIKey | KEBJZCCUKACYDE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-one?
The IUPAC name of 1-(3-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-one (CID 80529884) is 1-(3-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-one.
What is the SMILES notation for 1-(3-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-one?
The canonical SMILES for 1-(3-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-one is CC(CC(=O)c1sccc1Cl)C(C)(C)C.
What is the InChIKey of 1-(3-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-one?
The InChIKey is KEBJZCCUKACYDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClOS/c1-8(12(2,3)4)7-10(14)11-9(13)5-6-15-11/h5-6,8H,7H2,1-4H3.
What are the key properties of 1-(3-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-one?
1-(3-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-one has a molecular weight of 244.79 g/mol, XLogP of 4.66, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-one is sourced from PubChem (CID 80529884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).