C13H13ClOS — CID 80530277
(3-chlorothiophen-2-yl)-(2,5-dimethylphenyl)methanol (PubChem CID 80530277) has the molecular formula C13H13ClOS and a molecular weight of 252.77 g/mol. Its IUPAC name is (3-chlorothiophen-2-yl)-(2,5-dimethylphenyl)methanol.
| Compound Name | (3-chlorothiophen-2-yl)-(2,5-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 80530277 |
| Molecular Formula | C13H13ClOS |
| Molecular Weight | 252.77 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | (3-chlorothiophen-2-yl)-(2,5-dimethylphenyl)methanol |
| SMILES | Cc1ccc(C)c(C(O)c2sccc2Cl)c1 |
| InChI | InChI=1S/C13H13ClOS/c1-8-3-4-9(2)10(7-8)12(15)13-11(14)5-6-16-13/h3-7,12,15H,1-2H3 |
| InChIKey | GUKCMIVLAFOUTC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.77 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |