C9H8BrClF5NS — CID 80531411
1-(5-bromo-4-chlorothiophen-2-yl)-N-ethyl-2,2,3,3,3-pentafluoropropan-1-amine (PubChem CID 80531411) has the molecular formula C9H8BrClF5NS and a molecular weight of 372.58 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)-N-ethyl-2,2,3,3,3-pentafluoropropan-1-amine.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)-N-ethyl-2,2,3,3,3-pentafluoropropan-1-amine |
|---|---|
| PubChem CID | 80531411 |
| Molecular Formula | C9H8BrClF5NS |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 370.92 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)-N-ethyl-2,2,3,3,3-pentafluoropropan-1-amine |
| SMILES | CCNC(c1cc(Cl)c(Br)s1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8BrClF5NS/c1-2-17-6(8(12,13)9(14,15)16)5-3-4(11)7(10)18-5/h3,6,17H,2H2,1H3 |
| InChIKey | ZPFHOFGXLLWBSH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|