C10H10BrClF5NS — CID 80531425
1-(5-bromo-4-chlorothiophen-2-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine (PubChem CID 80531425) has the molecular formula C10H10BrClF5NS and a molecular weight of 386.61 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine.
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 80531425 |
| Molecular Formula | C10H10BrClF5NS |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine |
| SMILES | CCCNC(c1cc(Cl)c(Br)s1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10BrClF5NS/c1-2-3-18-7(9(13,14)10(15,16)17)6-4-5(12)8(11)19-6/h4,7,18H,2-3H2,1H3 |
| InChIKey | TWNGUAJRKOLSBX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|