C13H22ClNS — CID 80531932
3-(3-chlorothiophen-2-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine (PubChem CID 80531932) has the molecular formula C13H22ClNS and a molecular weight of 259.85 g/mol. Its IUPAC name is 3-(3-chlorothiophen-2-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine.
| Compound Name | 3-(3-chlorothiophen-2-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine |
|---|---|
| PubChem CID | 80531932 |
| Molecular Formula | C13H22ClNS |
| Molecular Weight | 259.85 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 3-(3-chlorothiophen-2-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine |
| SMILES | CC(C)CNCCC(C)(C)c1sccc1Cl |
| InChI | InChI=1S/C13H22ClNS/c1-10(2)9-15-7-6-13(3,4)12-11(14)5-8-16-12/h5,8,10,15H,6-7,9H2,1-4H3 |
| InChIKey | LHYLDJORCYXBKK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.85 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|