C15H23BrClNS — CID 80532063
N-[(5-bromo-4-chlorothiophen-2-yl)-cycloheptylmethyl]propan-1-amine (PubChem CID 80532063) has the molecular formula C15H23BrClNS and a molecular weight of 364.78 g/mol. Its IUPAC name is N-[(5-bromo-4-chlorothiophen-2-yl)-cycloheptylmethyl]propan-1-amine.
| Compound Name | N-[(5-bromo-4-chlorothiophen-2-yl)-cycloheptylmethyl]propan-1-amine |
|---|---|
| PubChem CID | 80532063 |
| Molecular Formula | C15H23BrClNS |
| Molecular Weight | 364.78 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N-[(5-bromo-4-chlorothiophen-2-yl)-cycloheptylmethyl]propan-1-amine |
| SMILES | CCCNC(c1cc(Cl)c(Br)s1)C1CCCCCC1 |
| InChI | InChI=1S/C15H23BrClNS/c1-2-9-18-14(11-7-5-3-4-6-8-11)13-10-12(17)15(16)19-13/h10-11,14,18H,2-9H2,1H3 |
| InChIKey | FKFKGQQGRUAFAO-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.78 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |