C12H12Br2ClNS2 — CID 80532243
N-[(5-bromo-4-chlorothiophen-2-yl)-(5-bromothiophen-2-yl)methyl]propan-1-amine (PubChem CID 80532243) has the molecular formula C12H12Br2ClNS2 and a molecular weight of 429.63 g/mol. Its IUPAC name is N-[(5-bromo-4-chlorothiophen-2-yl)-(5-bromothiophen-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-bromo-4-chlorothiophen-2-yl)-(5-bromothiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 80532243 |
| Molecular Formula | C12H12Br2ClNS2 |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 426.85 |
| IUPAC Name | N-[(5-bromo-4-chlorothiophen-2-yl)-(5-bromothiophen-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(Br)s1)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C12H12Br2ClNS2/c1-2-5-16-11(8-3-4-10(13)17-8)9-6-7(15)12(14)18-9/h3-4,6,11,16H,2,5H2,1H3 |
| InChIKey | NPOXDCRRTSRKFZ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |