About 1-(5-bromo-4-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-ol
1-(5-bromo-4-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-ol (PubChem CID 80532259) has the molecular formula C12H18BrClOS
and a molecular weight of 325.70 g/mol. Its IUPAC name is 1-(5-bromo-4-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-ol.
Molecular Properties
| Compound Name | 1-(5-bromo-4-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-ol |
| PubChem CID | 80532259 |
| Molecular Formula | C12H18BrClOS |
| Molecular Weight | 325.70 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 1-(5-bromo-4-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-ol |
| SMILES | CC(CC(O)c1cc(Cl)c(Br)s1)C(C)(C)C |
| InChI | InChI=1S/C12H18BrClOS/c1-7(12(2,3)4)5-9(15)10-6-8(14)11(13)16-10/h6-7,9,15H,5H2,1-4H3 |
| InChIKey | BQPRLWOFSAKGJP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.70 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-bromo-4-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-4-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-ol?
The IUPAC name of 1-(5-bromo-4-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-ol (CID 80532259) is 1-(5-bromo-4-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-ol.
What is the SMILES notation for 1-(5-bromo-4-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-ol?
The canonical SMILES for 1-(5-bromo-4-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-ol is CC(CC(O)c1cc(Cl)c(Br)s1)C(C)(C)C.
What is the InChIKey of 1-(5-bromo-4-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-ol?
The InChIKey is BQPRLWOFSAKGJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18BrClOS/c1-7(12(2,3)4)5-9(15)10-6-8(14)11(13)16-10/h6-7,9,15H,5H2,1-4H3.
What are the key properties of 1-(5-bromo-4-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-ol?
1-(5-bromo-4-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-ol has a molecular weight of 325.70 g/mol, XLogP of 5.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-4-chlorothiophen-2-yl)-3,4,4-trimethylpentan-1-ol is sourced from PubChem (CID 80532259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).