C11H8BrClN2OS — CID 80532463
(5-bromo-4-chlorothiophen-2-yl)-(2,4-diaminophenyl)methanone (PubChem CID 80532463) has the molecular formula C11H8BrClN2OS and a molecular weight of 331.62 g/mol. Its IUPAC name is (5-bromo-4-chlorothiophen-2-yl)-(2,4-diaminophenyl)methanone.
| Compound Name | (5-bromo-4-chlorothiophen-2-yl)-(2,4-diaminophenyl)methanone |
|---|---|
| PubChem CID | 80532463 |
| Molecular Formula | C11H8BrClN2OS |
| Molecular Weight | 331.62 g/mol |
| Exact Mass | 329.92 |
| IUPAC Name | (5-bromo-4-chlorothiophen-2-yl)-(2,4-diaminophenyl)methanone |
| SMILES | Nc1ccc(C(=O)c2cc(Cl)c(Br)s2)c(N)c1 |
| InChI | InChI=1S/C11H8BrClN2OS/c12-11-7(13)4-9(17-11)10(16)6-2-1-5(14)3-8(6)15/h1-4H,14-15H2 |
| InChIKey | PAPSNJVJEVGXDR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.62 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|