About cyclobutyl-(4,5-dibromothiophen-2-yl)methanone
cyclobutyl-(4,5-dibromothiophen-2-yl)methanone (PubChem CID 80532639) has the molecular formula C9H8Br2OS
and a molecular weight of 324.04 g/mol. Its IUPAC name is cyclobutyl-(4,5-dibromothiophen-2-yl)methanone.
Molecular Properties
| Compound Name | cyclobutyl-(4,5-dibromothiophen-2-yl)methanone |
| PubChem CID | 80532639 |
| Molecular Formula | C9H8Br2OS |
| Molecular Weight | 324.04 g/mol |
| Exact Mass | 321.87 |
| IUPAC Name | cyclobutyl-(4,5-dibromothiophen-2-yl)methanone |
| SMILES | O=C(c1cc(Br)c(Br)s1)C1CCC1 |
| InChI | InChI=1S/C9H8Br2OS/c10-6-4-7(13-9(6)11)8(12)5-2-1-3-5/h4-5H,1-3H2 |
| InChIKey | VXXOGLOXTIDCPA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.04 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclobutyl-(4,5-dibromothiophen-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl-(4,5-dibromothiophen-2-yl)methanone?
The IUPAC name of cyclobutyl-(4,5-dibromothiophen-2-yl)methanone (CID 80532639) is cyclobutyl-(4,5-dibromothiophen-2-yl)methanone.
What is the SMILES notation for cyclobutyl-(4,5-dibromothiophen-2-yl)methanone?
The canonical SMILES for cyclobutyl-(4,5-dibromothiophen-2-yl)methanone is O=C(c1cc(Br)c(Br)s1)C1CCC1.
What is the InChIKey of cyclobutyl-(4,5-dibromothiophen-2-yl)methanone?
The InChIKey is VXXOGLOXTIDCPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Br2OS/c10-6-4-7(13-9(6)11)8(12)5-2-1-3-5/h4-5H,1-3H2.
What are the key properties of cyclobutyl-(4,5-dibromothiophen-2-yl)methanone?
cyclobutyl-(4,5-dibromothiophen-2-yl)methanone has a molecular weight of 324.04 g/mol, XLogP of 4.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl-(4,5-dibromothiophen-2-yl)methanone is sourced from PubChem (CID 80532639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).