About 1-(4,5-dibromothiophen-2-yl)-1-(4-ethylphenyl)-N-methylmethanamine
1-(4,5-dibromothiophen-2-yl)-1-(4-ethylphenyl)-N-methylmethanamine (PubChem CID 80532956) has the molecular formula C14H15Br2NS
and a molecular weight of 389.16 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-1-(4-ethylphenyl)-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-1-(4-ethylphenyl)-N-methylmethanamine |
| PubChem CID | 80532956 |
| Molecular Formula | C14H15Br2NS |
| Molecular Weight | 389.16 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-1-(4-ethylphenyl)-N-methylmethanamine |
| SMILES | CCc1ccc(C(NC)c2cc(Br)c(Br)s2)cc1 |
| InChI | InChI=1S/C14H15Br2NS/c1-3-9-4-6-10(7-5-9)13(17-2)12-8-11(15)14(16)18-12/h4-8,13,17H,3H2,1-2H3 |
| InChIKey | KZEKFTXNMASCHU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.16 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4,5-dibromothiophen-2-yl)-1-(4-ethylphenyl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dibromothiophen-2-yl)-1-(4-ethylphenyl)-N-methylmethanamine?
The IUPAC name of 1-(4,5-dibromothiophen-2-yl)-1-(4-ethylphenyl)-N-methylmethanamine (CID 80532956) is 1-(4,5-dibromothiophen-2-yl)-1-(4-ethylphenyl)-N-methylmethanamine.
What is the SMILES notation for 1-(4,5-dibromothiophen-2-yl)-1-(4-ethylphenyl)-N-methylmethanamine?
The canonical SMILES for 1-(4,5-dibromothiophen-2-yl)-1-(4-ethylphenyl)-N-methylmethanamine is CCc1ccc(C(NC)c2cc(Br)c(Br)s2)cc1.
What is the InChIKey of 1-(4,5-dibromothiophen-2-yl)-1-(4-ethylphenyl)-N-methylmethanamine?
The InChIKey is KZEKFTXNMASCHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Br2NS/c1-3-9-4-6-10(7-5-9)13(17-2)12-8-11(15)14(16)18-12/h4-8,13,17H,3H2,1-2H3.
What are the key properties of 1-(4,5-dibromothiophen-2-yl)-1-(4-ethylphenyl)-N-methylmethanamine?
1-(4,5-dibromothiophen-2-yl)-1-(4-ethylphenyl)-N-methylmethanamine has a molecular weight of 389.16 g/mol, XLogP of 5.14, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dibromothiophen-2-yl)-1-(4-ethylphenyl)-N-methylmethanamine is sourced from PubChem (CID 80532956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).