C12H5Br2ClF4S — CID 80534598
2,3-dibromo-5-[chloro-[2-fluoro-3-(trifluoromethyl)phenyl]methyl]thiophene (PubChem CID 80534598) has the molecular formula C12H5Br2ClF4S and a molecular weight of 452.49 g/mol. Its IUPAC name is 2,3-dibromo-5-[chloro-[2-fluoro-3-(trifluoromethyl)phenyl]methyl]thiophene.
| Compound Name | 2,3-dibromo-5-[chloro-[2-fluoro-3-(trifluoromethyl)phenyl]methyl]thiophene |
|---|---|
| PubChem CID | 80534598 |
| Molecular Formula | C12H5Br2ClF4S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 449.81 |
| IUPAC Name | 2,3-dibromo-5-[chloro-[2-fluoro-3-(trifluoromethyl)phenyl]methyl]thiophene |
| SMILES | Fc1c(C(Cl)c2cc(Br)c(Br)s2)cccc1C(F)(F)F |
| InChI | InChI=1S/C12H5Br2ClF4S/c13-7-4-8(20-11(7)14)9(15)5-2-1-3-6(10(5)16)12(17,18)19/h1-4,9H |
| InChIKey | RYHDNJXUQHEPNC-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|