About 5-(4,5-dibromothiophen-2-yl)-N-methylpentan-1-amine
5-(4,5-dibromothiophen-2-yl)-N-methylpentan-1-amine (PubChem CID 80534928) has the molecular formula C10H15Br2NS
and a molecular weight of 341.11 g/mol. Its IUPAC name is 5-(4,5-dibromothiophen-2-yl)-N-methylpentan-1-amine.
Molecular Properties
| Compound Name | 5-(4,5-dibromothiophen-2-yl)-N-methylpentan-1-amine |
| PubChem CID | 80534928 |
| Molecular Formula | C10H15Br2NS |
| Molecular Weight | 341.11 g/mol |
| Exact Mass | 338.93 |
| IUPAC Name | 5-(4,5-dibromothiophen-2-yl)-N-methylpentan-1-amine |
| SMILES | CNCCCCCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H15Br2NS/c1-13-6-4-2-3-5-8-7-9(11)10(12)14-8/h7,13H,2-6H2,1H3 |
| InChIKey | PBTHVTREGIBQOY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.11 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4,5-dibromothiophen-2-yl)-N-methylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,5-dibromothiophen-2-yl)-N-methylpentan-1-amine?
The IUPAC name of 5-(4,5-dibromothiophen-2-yl)-N-methylpentan-1-amine (CID 80534928) is 5-(4,5-dibromothiophen-2-yl)-N-methylpentan-1-amine.
What is the SMILES notation for 5-(4,5-dibromothiophen-2-yl)-N-methylpentan-1-amine?
The canonical SMILES for 5-(4,5-dibromothiophen-2-yl)-N-methylpentan-1-amine is CNCCCCCc1cc(Br)c(Br)s1.
What is the InChIKey of 5-(4,5-dibromothiophen-2-yl)-N-methylpentan-1-amine?
The InChIKey is PBTHVTREGIBQOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15Br2NS/c1-13-6-4-2-3-5-8-7-9(11)10(12)14-8/h7,13H,2-6H2,1H3.
What are the key properties of 5-(4,5-dibromothiophen-2-yl)-N-methylpentan-1-amine?
5-(4,5-dibromothiophen-2-yl)-N-methylpentan-1-amine has a molecular weight of 341.11 g/mol, XLogP of 4.21, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,5-dibromothiophen-2-yl)-N-methylpentan-1-amine is sourced from PubChem (CID 80534928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).