About 2-[1-[2-(4,5-dibromothiophen-2-yl)ethyl]cyclohexyl]-N-methylethanamine
2-[1-[2-(4,5-dibromothiophen-2-yl)ethyl]cyclohexyl]-N-methylethanamine (PubChem CID 80535027) has the molecular formula C15H23Br2NS
and a molecular weight of 409.23 g/mol. Its IUPAC name is 2-[1-[2-(4,5-dibromothiophen-2-yl)ethyl]cyclohexyl]-N-methylethanamine.
Molecular Properties
| Compound Name | 2-[1-[2-(4,5-dibromothiophen-2-yl)ethyl]cyclohexyl]-N-methylethanamine |
| PubChem CID | 80535027 |
| Molecular Formula | C15H23Br2NS |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | 2-[1-[2-(4,5-dibromothiophen-2-yl)ethyl]cyclohexyl]-N-methylethanamine |
| SMILES | CNCCC1(CCc2cc(Br)c(Br)s2)CCCCC1 |
| InChI | InChI=1S/C15H23Br2NS/c1-18-10-9-15(6-3-2-4-7-15)8-5-12-11-13(16)14(17)19-12/h11,18H,2-10H2,1H3 |
| InChIKey | VSMRHJWAPUDTRC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-[2-(4,5-dibromothiophen-2-yl)ethyl]cyclohexyl]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[2-(4,5-dibromothiophen-2-yl)ethyl]cyclohexyl]-N-methylethanamine?
The IUPAC name of 2-[1-[2-(4,5-dibromothiophen-2-yl)ethyl]cyclohexyl]-N-methylethanamine (CID 80535027) is 2-[1-[2-(4,5-dibromothiophen-2-yl)ethyl]cyclohexyl]-N-methylethanamine.
What is the SMILES notation for 2-[1-[2-(4,5-dibromothiophen-2-yl)ethyl]cyclohexyl]-N-methylethanamine?
The canonical SMILES for 2-[1-[2-(4,5-dibromothiophen-2-yl)ethyl]cyclohexyl]-N-methylethanamine is CNCCC1(CCc2cc(Br)c(Br)s2)CCCCC1.
What is the InChIKey of 2-[1-[2-(4,5-dibromothiophen-2-yl)ethyl]cyclohexyl]-N-methylethanamine?
The InChIKey is VSMRHJWAPUDTRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23Br2NS/c1-18-10-9-15(6-3-2-4-7-15)8-5-12-11-13(16)14(17)19-12/h11,18H,2-10H2,1H3.
What are the key properties of 2-[1-[2-(4,5-dibromothiophen-2-yl)ethyl]cyclohexyl]-N-methylethanamine?
2-[1-[2-(4,5-dibromothiophen-2-yl)ethyl]cyclohexyl]-N-methylethanamine has a molecular weight of 409.23 g/mol, XLogP of 5.77, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2-(4,5-dibromothiophen-2-yl)ethyl]cyclohexyl]-N-methylethanamine is sourced from PubChem (CID 80535027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).