C13H12BrClFNS — CID 80535170
N-[(3-bromothiophen-2-yl)-(5-chloro-2-fluorophenyl)methyl]ethanamine (PubChem CID 80535170) has the molecular formula C13H12BrClFNS and a molecular weight of 348.67 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)-(5-chloro-2-fluorophenyl)methyl]ethanamine.
| Compound Name | N-[(3-bromothiophen-2-yl)-(5-chloro-2-fluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 80535170 |
| Molecular Formula | C13H12BrClFNS |
| Molecular Weight | 348.67 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)-(5-chloro-2-fluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1cc(Cl)ccc1F)c1sccc1Br |
| InChI | InChI=1S/C13H12BrClFNS/c1-2-17-12(13-10(14)5-6-18-13)9-7-8(15)3-4-11(9)16/h3-7,12,17H,2H2,1H3 |
| InChIKey | NCXSBIRPJWULQM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.67 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |