C13H6Br2N2O3S — CID 80537038
3-[5-(4,5-dibromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid (PubChem CID 80537038) has the molecular formula C13H6Br2N2O3S and a molecular weight of 430.08 g/mol. Its IUPAC name is 3-[5-(4,5-dibromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid.
| Compound Name | 3-[5-(4,5-dibromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 80537038 |
| Molecular Formula | C13H6Br2N2O3S |
| Molecular Weight | 430.08 g/mol |
| Exact Mass | 427.85 |
| IUPAC Name | 3-[5-(4,5-dibromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2nnc(-c3cc(Br)c(Br)s3)o2)c1 |
| InChI | InChI=1S/C13H6Br2N2O3S/c14-8-5-9(21-10(8)15)12-17-16-11(20-12)6-2-1-3-7(4-6)13(18)19/h1-5H,(H,18,19) |
| InChIKey | DSRNSGWNVIYJDL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.08 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |