About 2-(4,5-dibromothiophen-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine
2-(4,5-dibromothiophen-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine (PubChem CID 80537885) has the molecular formula C11H7Br2N3S
and a molecular weight of 373.07 g/mol. Its IUPAC name is 2-(4,5-dibromothiophen-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-(4,5-dibromothiophen-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 80537885 |
| Molecular Formula | C11H7Br2N3S |
| Molecular Weight | 373.07 g/mol |
| Exact Mass | 370.87 |
| IUPAC Name | 2-(4,5-dibromothiophen-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine |
| SMILES | Cc1ccnc2nc(-c3cc(Br)c(Br)s3)[nH]c12 |
| InChI | InChI=1S/C11H7Br2N3S/c1-5-2-3-14-11-8(5)15-10(16-11)7-4-6(12)9(13)17-7/h2-4H,1H3,(H,14,15,16) |
| InChIKey | MXBZOWAJYSBYCQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.07 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,5-dibromothiophen-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dibromothiophen-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 2-(4,5-dibromothiophen-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine (CID 80537885) is 2-(4,5-dibromothiophen-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 2-(4,5-dibromothiophen-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 2-(4,5-dibromothiophen-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine is Cc1ccnc2nc(-c3cc(Br)c(Br)s3)[nH]c12.
What is the InChIKey of 2-(4,5-dibromothiophen-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine?
The InChIKey is MXBZOWAJYSBYCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Br2N3S/c1-5-2-3-14-11-8(5)15-10(16-11)7-4-6(12)9(13)17-7/h2-4H,1H3,(H,14,15,16).
What are the key properties of 2-(4,5-dibromothiophen-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine?
2-(4,5-dibromothiophen-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine has a molecular weight of 373.07 g/mol, XLogP of 4.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dibromothiophen-2-yl)-7-methyl-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 80537885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).