C6H2Br2N2OS2 — CID 80537920
5-(4,5-dibromothiophen-2-yl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 80537920) has the molecular formula C6H2Br2N2OS2 and a molecular weight of 342.04 g/mol. Its IUPAC name is 5-(4,5-dibromothiophen-2-yl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(4,5-dibromothiophen-2-yl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 80537920 |
| Molecular Formula | C6H2Br2N2OS2 |
| Molecular Weight | 342.04 g/mol |
| Exact Mass | 339.80 |
| IUPAC Name | 5-(4,5-dibromothiophen-2-yl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(-c2cc(Br)c(Br)s2)o1 |
| InChI | InChI=1S/C6H2Br2N2OS2/c7-2-1-3(13-4(2)8)5-9-10-6(12)11-5/h1H,(H,10,12) |
| InChIKey | IRDLPSPHAAPERD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.04 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|