About 2-[1-bromo-1-(4,5-dibromothiophen-2-yl)propan-2-yl]pyridine
2-[1-bromo-1-(4,5-dibromothiophen-2-yl)propan-2-yl]pyridine (PubChem CID 80538097) has the molecular formula C12H10Br3NS
and a molecular weight of 440.00 g/mol. Its IUPAC name is 2-[1-bromo-1-(4,5-dibromothiophen-2-yl)propan-2-yl]pyridine.
Molecular Properties
| Compound Name | 2-[1-bromo-1-(4,5-dibromothiophen-2-yl)propan-2-yl]pyridine |
| PubChem CID | 80538097 |
| Molecular Formula | C12H10Br3NS |
| Molecular Weight | 440.00 g/mol |
| Exact Mass | 436.81 |
| IUPAC Name | 2-[1-bromo-1-(4,5-dibromothiophen-2-yl)propan-2-yl]pyridine |
| SMILES | CC(c1ccccn1)C(Br)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H10Br3NS/c1-7(9-4-2-3-5-16-9)11(14)10-6-8(13)12(15)17-10/h2-7,11H,1H3 |
| InChIKey | MPEMKCHEHABCDX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.00 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-bromo-1-(4,5-dibromothiophen-2-yl)propan-2-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-bromo-1-(4,5-dibromothiophen-2-yl)propan-2-yl]pyridine?
The IUPAC name of 2-[1-bromo-1-(4,5-dibromothiophen-2-yl)propan-2-yl]pyridine (CID 80538097) is 2-[1-bromo-1-(4,5-dibromothiophen-2-yl)propan-2-yl]pyridine.
What is the SMILES notation for 2-[1-bromo-1-(4,5-dibromothiophen-2-yl)propan-2-yl]pyridine?
The canonical SMILES for 2-[1-bromo-1-(4,5-dibromothiophen-2-yl)propan-2-yl]pyridine is CC(c1ccccn1)C(Br)c1cc(Br)c(Br)s1.
What is the InChIKey of 2-[1-bromo-1-(4,5-dibromothiophen-2-yl)propan-2-yl]pyridine?
The InChIKey is MPEMKCHEHABCDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Br3NS/c1-7(9-4-2-3-5-16-9)11(14)10-6-8(13)12(15)17-10/h2-7,11H,1H3.
What are the key properties of 2-[1-bromo-1-(4,5-dibromothiophen-2-yl)propan-2-yl]pyridine?
2-[1-bromo-1-(4,5-dibromothiophen-2-yl)propan-2-yl]pyridine has a molecular weight of 440.00 g/mol, XLogP of 5.91, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-bromo-1-(4,5-dibromothiophen-2-yl)propan-2-yl]pyridine is sourced from PubChem (CID 80538097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).