About 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine
3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine (PubChem CID 80539787) has the molecular formula C12H14ClN3O
and a molecular weight of 251.72 g/mol. Its IUPAC name is 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine.
Molecular Properties
| Compound Name | 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine |
| PubChem CID | 80539787 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine |
| SMILES | CC(CCN)c1nc(-c2ccccc2Cl)no1 |
| InChI | InChI=1S/C12H14ClN3O/c1-8(6-7-14)12-15-11(16-17-12)9-4-2-3-5-10(9)13/h2-5,8H,6-7,14H2,1H3 |
| InChIKey | STZUANVFUQAPLP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine?
The IUPAC name of 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine (CID 80539787) is 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine.
What is the SMILES notation for 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine?
The canonical SMILES for 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine is CC(CCN)c1nc(-c2ccccc2Cl)no1.
What is the InChIKey of 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine?
The InChIKey is STZUANVFUQAPLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN3O/c1-8(6-7-14)12-15-11(16-17-12)9-4-2-3-5-10(9)13/h2-5,8H,6-7,14H2,1H3.
What are the key properties of 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine?
3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine has a molecular weight of 251.72 g/mol, XLogP of 2.84, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine is sourced from PubChem (CID 80539787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).