C11H20N2O4 — CID 80540824
4-[(4-hydroxypiperidine-1-carbonyl)amino]-2-methylbutanoic acid (PubChem CID 80540824) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-[(4-hydroxypiperidine-1-carbonyl)amino]-2-methylbutanoic acid.
| Compound Name | 4-[(4-hydroxypiperidine-1-carbonyl)amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 80540824 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 4-[(4-hydroxypiperidine-1-carbonyl)amino]-2-methylbutanoic acid |
| SMILES | CC(CCNC(=O)N1CCC(O)CC1)C(=O)O |
| InChI | InChI=1S/C11H20N2O4/c1-8(10(15)16)2-5-12-11(17)13-6-3-9(14)4-7-13/h8-9,14H,2-7H2,1H3,(H,12,17)(H,15,16) |
| InChIKey | ABGGTSYLGAZEIA-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |