C14H20F2N2O — CID 80542917
4-amino-N-[1-(3,4-difluorophenyl)ethyl]-N,2-dimethylbutanamide (PubChem CID 80542917) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is 4-amino-N-[1-(3,4-difluorophenyl)ethyl]-N,2-dimethylbutanamide.
| Compound Name | 4-amino-N-[1-(3,4-difluorophenyl)ethyl]-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 80542917 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 4-amino-N-[1-(3,4-difluorophenyl)ethyl]-N,2-dimethylbutanamide |
| SMILES | CC(CCN)C(=O)N(C)C(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H20F2N2O/c1-9(6-7-17)14(19)18(3)10(2)11-4-5-12(15)13(16)8-11/h4-5,8-10H,6-7,17H2,1-3H3 |
| InChIKey | LTSFNFGZXJFRPQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |